C31H32N2O10S2 — CID 74412292
6-[2-[[3-[(3,3-dimethyl-5-sulfoindol-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid (PubChem CID 74412292) has the molecular formula C31H32N2O10S2 and a molecular weight of 656.74 g/mol. Its IUPAC name is 6-[2-[[3-[(3,3-dimethyl-5-sulfoindol-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid.
| Compound Name | 6-[2-[[3-[(3,3-dimethyl-5-sulfoindol-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 74412292 |
| Molecular Formula | C31H32N2O10S2 |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 656.15 |
| IUPAC Name | 6-[2-[[3-[(3,3-dimethyl-5-sulfoindol-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid |
| SMILES | CC1(C)C(C=C2C(=O)C(C=C3Nc4ccc(S(=O)(=O)O)cc4C3(C)CCCCCC(=O)O)=C2O)=Nc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C31H32N2O10S2/c1-30(2)21-13-17(44(38,39)40)8-10-23(21)32-25(30)15-19-28(36)20(29(19)37)16-26-31(3,12-6-4-5-7-27(34)35)22-14-18(45(41,42)43)9-11-24(22)33-26/h8-11,13-16,33,36H,4-7,12H2,1-3H3,(H,34,35)(H,38,39,40)(H,41,42,43) |
| InChIKey | QOQLGFUCHXZRFF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 207.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|