C34H44N2O12S3 — CID 89344596
6-[(2E)-2-[(2E,4E)-5-[2-hydroxy-3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-2-yl]penta-2,4-dienylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid (PubChem CID 89344596) has the molecular formula C34H44N2O12S3 and a molecular weight of 768.93 g/mol. Its IUPAC name is 6-[(2E)-2-[(2E,4E)-5-[2-hydroxy-3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-2-yl]penta-2,4-dienylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(2E,4E)-5-[2-hydroxy-3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-2-yl]penta-2,4-dienylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 89344596 |
| Molecular Formula | C34H44N2O12S3 |
| Molecular Weight | 768.93 g/mol |
| Exact Mass | 768.21 |
| IUPAC Name | 6-[(2E)-2-[(2E,4E)-5-[2-hydroxy-3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-2-yl]penta-2,4-dienylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid |
| SMILES | CC1(CCCCCC(=O)O)/C(=C\C=C\C=C\C2(O)N(CCCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)Nc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C34H44N2O12S3/c1-32(2)27-23-25(51(46,47)48)15-17-29(27)36(20-10-11-21-49(40,41)42)34(32,39)19-9-4-6-12-30-33(3,18-8-5-7-13-31(37)38)26-22-24(50(43,44)45)14-16-28(26)35-30/h4,6,9,12,14-17,19,22-23,35,39H,5,7-8,10-11,13,18,20-21H2,1-3H3,(H,37,38)(H,40,41,42)(H,43,44,45)(H,46,47,48)/b6-4+,19-9+,30-12+ |
| InChIKey | NFHFJYSIRIHNQG-POZMWXQTSA-N |
| XLogP | 5.05 |
| TPSA | 235.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.93 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|