C19H29NO8S2 — CID 141383564
6-[2,3-dimethyl-5-sulfo-3-(3-sulfopropyl)-2H-indol-1-yl]hexanoic acid (PubChem CID 141383564) has the molecular formula C19H29NO8S2 and a molecular weight of 463.57 g/mol. Its IUPAC name is 6-[2,3-dimethyl-5-sulfo-3-(3-sulfopropyl)-2H-indol-1-yl]hexanoic acid.
| Compound Name | 6-[2,3-dimethyl-5-sulfo-3-(3-sulfopropyl)-2H-indol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 141383564 |
| Molecular Formula | C19H29NO8S2 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 6-[2,3-dimethyl-5-sulfo-3-(3-sulfopropyl)-2H-indol-1-yl]hexanoic acid |
| SMILES | CC1N(CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C19H29NO8S2/c1-14-19(2,10-6-12-29(23,24)25)16-13-15(30(26,27)28)8-9-17(16)20(14)11-5-3-4-7-18(21)22/h8-9,13-14H,3-7,10-12H2,1-2H3,(H,21,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | UITQUFWBGJNZEQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|