C21H25NO8S2 — CID 129058860
4-[[2,3-dimethyl-5-sulfo-1-(3-sulfopropyl)-2H-indol-3-yl]methyl]benzoic acid (PubChem CID 129058860) has the molecular formula C21H25NO8S2 and a molecular weight of 483.56 g/mol. Its IUPAC name is 4-[[2,3-dimethyl-5-sulfo-1-(3-sulfopropyl)-2H-indol-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[2,3-dimethyl-5-sulfo-1-(3-sulfopropyl)-2H-indol-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 129058860 |
| Molecular Formula | C21H25NO8S2 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 4-[[2,3-dimethyl-5-sulfo-1-(3-sulfopropyl)-2H-indol-3-yl]methyl]benzoic acid |
| SMILES | CC1N(CCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H25NO8S2/c1-14-21(2,13-15-4-6-16(7-5-15)20(23)24)18-12-17(32(28,29)30)8-9-19(18)22(14)10-3-11-31(25,26)27/h4-9,12,14H,3,10-11,13H2,1-2H3,(H,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | PJQGESNELVJXLZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|