C19H21NO2 — CID 141175126
4-[(2,3,3-trimethyl-2H-indol-1-yl)methyl]benzoic acid (PubChem CID 141175126) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-[(2,3,3-trimethyl-2H-indol-1-yl)methyl]benzoic acid.
| Compound Name | 4-[(2,3,3-trimethyl-2H-indol-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 141175126 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-[(2,3,3-trimethyl-2H-indol-1-yl)methyl]benzoic acid |
| SMILES | CC1N(Cc2ccc(C(=O)O)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C19H21NO2/c1-13-19(2,3)16-6-4-5-7-17(16)20(13)12-14-8-10-15(11-9-14)18(21)22/h4-11,13H,12H2,1-3H3,(H,21,22) |
| InChIKey | ZLFAMIZTWMGWEK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |