C19H30BrNO2 — CID 173098178
hexyl 2-(2,3,3-trimethyl-2H-indol-1-yl)acetate;hydrobromide (PubChem CID 173098178) has the molecular formula C19H30BrNO2 and a molecular weight of 384.36 g/mol. Its IUPAC name is hexyl 2-(2,3,3-trimethyl-2H-indol-1-yl)acetate;hydrobromide.
| Compound Name | hexyl 2-(2,3,3-trimethyl-2H-indol-1-yl)acetate;hydrobromide |
|---|---|
| PubChem CID | 173098178 |
| Molecular Formula | C19H30BrNO2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | hexyl 2-(2,3,3-trimethyl-2H-indol-1-yl)acetate;hydrobromide |
| SMILES | Br.CCCCCCOC(=O)CN1c2ccccc2C(C)(C)C1C |
| InChI | InChI=1S/C19H29NO2.BrH/c1-5-6-7-10-13-22-18(21)14-20-15(2)19(3,4)16-11-8-9-12-17(16)20;/h8-9,11-12,15H,5-7,10,13-14H2,1-4H3;1H |
| InChIKey | QHRCMRUOZZPPSY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|