C15H23N — CID 162296328
1-tert-butyl-2,3,3-trimethyl-2H-indole (PubChem CID 162296328) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-tert-butyl-2,3,3-trimethyl-2H-indole.
| Compound Name | 1-tert-butyl-2,3,3-trimethyl-2H-indole |
|---|---|
| PubChem CID | 162296328 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-tert-butyl-2,3,3-trimethyl-2H-indole |
| SMILES | CC1N(C(C)(C)C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C15H23N/c1-11-15(5,6)12-9-7-8-10-13(12)16(11)14(2,3)4/h7-11H,1-6H3 |
| InChIKey | MURSMOBTXUEFHZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |