C20H29IN2 — CID 161089434
dimethyl(phenyl)azanium;1,2,3,3-tetramethyl-2H-indole;iodide (PubChem CID 161089434) has the molecular formula C20H29IN2 and a molecular weight of 424.37 g/mol. Its IUPAC name is dimethyl(phenyl)azanium;1,2,3,3-tetramethyl-2H-indole;iodide.
| Compound Name | dimethyl(phenyl)azanium;1,2,3,3-tetramethyl-2H-indole;iodide |
|---|---|
| PubChem CID | 161089434 |
| Molecular Formula | C20H29IN2 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | dimethyl(phenyl)azanium;1,2,3,3-tetramethyl-2H-indole;iodide |
| SMILES | CC1N(C)c2ccccc2C1(C)C.C[NH+](C)c1ccccc1.[I-] |
| InChI | InChI=1S/C12H17N.C8H11N.HI/c1-9-12(2,3)10-7-5-6-8-11(10)13(9)4;1-9(2)8-6-4-3-5-7-8;/h5-9H,1-4H3;3-7H,1-2H3;1H |
| InChIKey | WTCYIJGINNMUPA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|