C12H16NO3S- — CID 2307444
(2R)-1,2,3,3-tetramethyl-2H-indole-5-sulfonate (PubChem CID 2307444) has the molecular formula C12H16NO3S- and a molecular weight of 254.33 g/mol. Its IUPAC name is (2R)-1,2,3,3-tetramethyl-2H-indole-5-sulfonate.
| Compound Name | (2R)-1,2,3,3-tetramethyl-2H-indole-5-sulfonate |
|---|---|
| PubChem CID | 2307444 |
| Molecular Formula | C12H16NO3S- |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2R)-1,2,3,3-tetramethyl-2H-indole-5-sulfonate |
| SMILES | C[C@H]1N(C)c2ccc(S(=O)(=O)[O-])cc2C1(C)C |
| InChI | InChI=1S/C12H17NO3S/c1-8-12(2,3)10-7-9(17(14,15)16)5-6-11(10)13(8)4/h5-8H,1-4H3,(H,14,15,16)/p-1/t8-/m1/s1 |
| InChIKey | BLVOOYINOLCUHY-MRVPVSSYSA-M |
| XLogP | 1.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|