C27H31BrN2O3S — CID 175823615
2-[(1E,3Z,5E)-3-bromo-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]-1,3,3-trimethyl-2H-indole-5-sulfonic acid (PubChem CID 175823615) has the molecular formula C27H31BrN2O3S and a molecular weight of 543.53 g/mol. Its IUPAC name is 2-[(1E,3Z,5E)-3-bromo-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]-1,3,3-trimethyl-2H-indole-5-sulfonic acid.
| Compound Name | 2-[(1E,3Z,5E)-3-bromo-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]-1,3,3-trimethyl-2H-indole-5-sulfonic acid |
|---|---|
| PubChem CID | 175823615 |
| Molecular Formula | C27H31BrN2O3S |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 2-[(1E,3Z,5E)-3-bromo-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]-1,3,3-trimethyl-2H-indole-5-sulfonic acid |
| SMILES | CN1/C(=C/C=C(Br)/C=C/C2N(C)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C27H31BrN2O3S/c1-26(2)20-9-7-8-10-22(20)29(5)24(26)15-11-18(28)12-16-25-27(3,4)21-17-19(34(31,32)33)13-14-23(21)30(25)6/h7-17,25H,1-6H3,(H,31,32,33)/b16-12+,18-11-,24-15+ |
| InChIKey | QEFUXNXTSXJRHH-AXFRHAFXSA-N |
| XLogP | 6.18 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|