C34H41ClN2 — CID 163149464
2-[2-[2-chloro-3-[2-(1,3,3,5-tetramethyl-2H-indol-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,3,3,5-tetramethylindole (PubChem CID 163149464) has the molecular formula C34H41ClN2 and a molecular weight of 513.17 g/mol. Its IUPAC name is 2-[2-[2-chloro-3-[2-(1,3,3,5-tetramethyl-2H-indol-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,3,3,5-tetramethylindole.
| Compound Name | 2-[2-[2-chloro-3-[2-(1,3,3,5-tetramethyl-2H-indol-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,3,3,5-tetramethylindole |
|---|---|
| PubChem CID | 163149464 |
| Molecular Formula | C34H41ClN2 |
| Molecular Weight | 513.17 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 2-[2-[2-chloro-3-[2-(1,3,3,5-tetramethyl-2H-indol-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,3,3,5-tetramethylindole |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(=CC=C1CCCC(C=CC3N(C)c4ccc(C)cc4C3(C)C)=C1Cl)N2C |
| InChI | InChI=1S/C34H41ClN2/c1-22-12-16-28-26(20-22)33(3,4)30(36(28)7)18-14-24-10-9-11-25(32(24)35)15-19-31-34(5,6)27-21-23(2)13-17-29(27)37(31)8/h12-21,30H,9-11H2,1-8H3 |
| InChIKey | MUNBZEIGQNQHCY-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.17 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |