C27H28ClNO2 — CID 59595215
4-[(E)-2-[(3E)-2-chloro-3-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]benzene-1,2-diol (PubChem CID 59595215) has the molecular formula C27H28ClNO2 and a molecular weight of 433.98 g/mol. Its IUPAC name is 4-[(E)-2-[(3E)-2-chloro-3-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-2-[(3E)-2-chloro-3-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 59595215 |
| Molecular Formula | C27H28ClNO2 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-[(E)-2-[(3E)-2-chloro-3-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]benzene-1,2-diol |
| SMILES | CN1/C(=C\C=C2/CCCC(/C=C/c3ccc(O)c(O)c3)=C2Cl)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C27H28ClNO2/c1-27(2)21-9-4-5-10-22(21)29(3)25(27)16-14-20-8-6-7-19(26(20)28)13-11-18-12-15-23(30)24(31)17-18/h4-5,9-17,30-31H,6-8H2,1-3H3/b13-11+,20-14+,25-16- |
| InChIKey | NRBHYRRYXPFRTN-GZUIHUMASA-N |
| XLogP | 7.03 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|