C31H39N3 — CID 122695899
N-[(E,6E)-4-[(E)-2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]-6-(1,3,3-trimethylindol-2-ylidene)hex-4-enyl]methanimine (PubChem CID 122695899) has the molecular formula C31H39N3 and a molecular weight of 453.67 g/mol. Its IUPAC name is N-[(E,6E)-4-[(E)-2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]-6-(1,3,3-trimethylindol-2-ylidene)hex-4-enyl]methanimine.
| Compound Name | N-[(E,6E)-4-[(E)-2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]-6-(1,3,3-trimethylindol-2-ylidene)hex-4-enyl]methanimine |
|---|---|
| PubChem CID | 122695899 |
| Molecular Formula | C31H39N3 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | N-[(E,6E)-4-[(E)-2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]-6-(1,3,3-trimethylindol-2-ylidene)hex-4-enyl]methanimine |
| SMILES | C=NCCCC(/C=C/C1N(C)c2ccccc2C1(C)C)=C\C=C1\N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C31H39N3/c1-30(2)24-14-8-10-16-26(24)33(6)28(30)20-18-23(13-12-22-32-5)19-21-29-31(3,4)25-15-9-11-17-27(25)34(29)7/h8-11,14-21,28H,5,12-13,22H2,1-4,6-7H3/b20-18+,23-19+,29-21+ |
| InChIKey | WNEGYFRXKAORHH-PQRQDRCGSA-N |
| XLogP | 7.06 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|