C31H42N2 — CID 58898863
(2E)-1-butyl-2-[(E)-3-(1-butyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindole (PubChem CID 58898863) has the molecular formula C31H42N2 and a molecular weight of 442.69 g/mol. Its IUPAC name is (2E)-1-butyl-2-[(E)-3-(1-butyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindole.
| Compound Name | (2E)-1-butyl-2-[(E)-3-(1-butyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindole |
|---|---|
| PubChem CID | 58898863 |
| Molecular Formula | C31H42N2 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | (2E)-1-butyl-2-[(E)-3-(1-butyl-3,3-dimethyl-2H-indol-2-yl)prop-2-enylidene]-3,3-dimethylindole |
| SMILES | CCCCN1/C(=C/C=C/C2N(CCCC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H42N2/c1-7-9-22-32-26-18-13-11-16-24(26)30(3,4)28(32)20-15-21-29-31(5,6)25-17-12-14-19-27(25)33(29)23-10-8-2/h11-21,28H,7-10,22-23H2,1-6H3/b20-15+,29-21+ |
| InChIKey | QZIJPQDEBCDNEX-LWHKYAQLSA-N |
| XLogP | 7.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|