C19H19NO2 — CID 177433367
(6Z)-4-hydroxy-6-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one (PubChem CID 177433367) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (6Z)-4-hydroxy-6-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | (6Z)-4-hydroxy-6-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 177433367 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (6Z)-4-hydroxy-6-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one |
| SMILES | CN1/C(=C\C=C2\C=C(O)C=CC2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H19NO2/c1-19(2)15-6-4-5-7-16(15)20(3)18(19)11-8-13-12-14(21)9-10-17(13)22/h4-12,21H,1-3H3/b13-8-,18-11- |
| InChIKey | BYSAZWICZOANEX-VNVCMORXSA-N |
| XLogP | 3.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|