C25H31N3O+2 — CID 102050470
3-[2-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-2-ylidene]ethylidene]-4-oxocyclohexa-1,5-diene-1-carbonitrilium (PubChem CID 102050470) has the molecular formula C25H31N3O+2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-[2-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-2-ylidene]ethylidene]-4-oxocyclohexa-1,5-diene-1-carbonitrilium.
| Compound Name | 3-[2-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-2-ylidene]ethylidene]-4-oxocyclohexa-1,5-diene-1-carbonitrilium |
|---|---|
| PubChem CID | 102050470 |
| Molecular Formula | C25H31N3O+2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 3-[2-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-2-ylidene]ethylidene]-4-oxocyclohexa-1,5-diene-1-carbonitrilium |
| SMILES | CC1(C)C(=CC=C2C=C(C#[NH+])C=CC2=O)N(CCC[N+](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C25H30N3O/c1-25(2)21-9-6-7-10-22(21)27(15-8-16-28(3,4)5)24(25)14-12-20-17-19(18-26)11-13-23(20)29/h6-7,9-14,17H,8,15-16H2,1-5H3/q+1/p+1 |
| InChIKey | NONWBDGJHUVTKT-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 44.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|