C27H36N3O3+ — CID 177483210
6-[(2E)-3,3-dimethyl-2-[(2Z)-2-(3-nitro-6-oxocyclohexa-2,4-dien-1-ylidene)ethylidene]indol-1-yl]hexyl-trimethylazanium (PubChem CID 177483210) has the molecular formula C27H36N3O3+ and a molecular weight of 450.60 g/mol. Its IUPAC name is 6-[(2E)-3,3-dimethyl-2-[(2Z)-2-(3-nitro-6-oxocyclohexa-2,4-dien-1-ylidene)ethylidene]indol-1-yl]hexyl-trimethylazanium.
| Compound Name | 6-[(2E)-3,3-dimethyl-2-[(2Z)-2-(3-nitro-6-oxocyclohexa-2,4-dien-1-ylidene)ethylidene]indol-1-yl]hexyl-trimethylazanium |
|---|---|
| PubChem CID | 177483210 |
| Molecular Formula | C27H36N3O3+ |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 6-[(2E)-3,3-dimethyl-2-[(2Z)-2-(3-nitro-6-oxocyclohexa-2,4-dien-1-ylidene)ethylidene]indol-1-yl]hexyl-trimethylazanium |
| SMILES | CC1(C)/C(=C\C=C2\C=C([N+](=O)[O-])C=CC2=O)N(CCCCCC[N+](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C27H36N3O3/c1-27(2)23-12-8-9-13-24(23)28(18-10-6-7-11-19-30(3,4)5)26(27)17-14-21-20-22(29(32)33)15-16-25(21)31/h8-9,12-17,20H,6-7,10-11,18-19H2,1-5H3/q+1/b21-14-,26-17+ |
| InChIKey | OKOUUSJIKQRTTA-ZTJKWIRZSA-N |
| XLogP | 5.16 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|