C38H38N4O6 — CID 158234555
deuterium monohydride;4-nitro-6-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one;1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 158234555) has the molecular formula C38H38N4O6 and a molecular weight of 647.75 g/mol. Its IUPAC name is deuterium monohydride;4-nitro-6-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one;1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | deuterium monohydride;4-nitro-6-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one;1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 158234555 |
| Molecular Formula | C38H38N4O6 |
| Molecular Weight | 647.75 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | deuterium monohydride;4-nitro-6-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one;1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CN1C(=CC=C2C=C([N+](=O)[O-])C=CC2=O)C(C)(C)c2ccccc21.CN1c2ccccc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2.[H][2H] |
| InChI | InChI=1S/2C19H18N2O3.H2/c1-18(2)15-6-4-5-7-16(15)20(3)19(18)11-10-13-12-14(21(22)23)8-9-17(13)24-19;1-19(2)15-6-4-5-7-16(15)20(3)18(19)11-8-13-12-14(21(23)24)9-10-17(13)22;/h2*4-12H,1-3H3;1H/i;;1+1 |
| InChIKey | GEUMLKGGFSIABL-FCHARDOESA-N |
| XLogP | 7.89 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.75 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|