C40H38N2O4 — CID 139060476
(2S)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde (PubChem CID 139060476) has the molecular formula C40H38N2O4 and a molecular weight of 610.75 g/mol. Its IUPAC name is (2S)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde.
| Compound Name | (2S)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde |
|---|---|
| PubChem CID | 139060476 |
| Molecular Formula | C40H38N2O4 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | (2S)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde |
| SMILES | CN1c2ccccc2C(C)(C)[C@@]12C=Cc1cc(C=O)ccc1O2.CN1c2ccccc2C(C)(C)[C@@]12C=Cc1cc(C=O)ccc1O2 |
| InChI | InChI=1S/2C20H19NO2/c2*1-19(2)16-6-4-5-7-17(16)21(3)20(19)11-10-15-12-14(13-22)8-9-18(15)23-20/h2*4-13H,1-3H3/t2*20-/m00/s1 |
| InChIKey | FIKQKXLTOJLILE-UHUPAWRPSA-N |
| XLogP | 8.06 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|