C23H25NO3S — CID 172523638
3-sulfanylpropyl 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carboxylate (PubChem CID 172523638) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is 3-sulfanylpropyl 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carboxylate.
| Compound Name | 3-sulfanylpropyl 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carboxylate |
|---|---|
| PubChem CID | 172523638 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-sulfanylpropyl 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carboxylate |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1cc(C(=O)OCCCS)ccc1O2 |
| InChI | InChI=1S/C23H25NO3S/c1-22(2)18-7-4-5-8-19(18)24(3)23(22)12-11-16-15-17(9-10-20(16)27-23)21(25)26-13-6-14-28/h4-5,7-12,15,28H,6,13-14H2,1-3H3 |
| InChIKey | JCWHHDBUUKCQFO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|