C22H20N2O — CID 10758678
(E)-3-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)prop-2-enenitrile (PubChem CID 10758678) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (E)-3-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 10758678 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (E)-3-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)prop-2-enenitrile |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1cc(/C=C/C#N)ccc1O2 |
| InChI | InChI=1S/C22H20N2O/c1-21(2)18-8-4-5-9-19(18)24(3)22(21)13-12-17-15-16(7-6-14-23)10-11-20(17)25-22/h4-13,15H,1-3H3/b7-6+ |
| InChIKey | SXKFJQJESZCRLT-VOTSOKGWSA-N |
| XLogP | 4.75 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|