C24H25NO3 — CID 10926893
ethyl (E)-3-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)prop-2-enoate (PubChem CID 10926893) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl (E)-3-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 10926893 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | ethyl (E)-3-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc2c(c1)C=CC1(O2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C24H25NO3/c1-5-27-22(26)13-11-17-10-12-21-18(16-17)14-15-24(28-21)23(2,3)19-8-6-7-9-20(19)25(24)4/h6-16H,5H2,1-4H3/b13-11+ |
| InChIKey | JGMAAOWKANBBGP-ACCUITESSA-N |
| XLogP | 4.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|