C24H24N2O5 — CID 7327401
[(2R)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl]methyl 2-methylprop-2-enoate (PubChem CID 7327401) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [(2R)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [(2R)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 7327401 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [(2R)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc([N+](=O)[O-])cc2c1O[C@@]1(C=C2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C24H24N2O5/c1-15(2)22(27)30-14-17-13-18(26(28)29)12-16-10-11-24(31-21(16)17)23(3,4)19-8-6-7-9-20(19)25(24)5/h6-13H,1,14H2,2-5H3/t24-/m1/s1 |
| InChIKey | NOERUYRJLFIFRZ-XMMPIXPASA-N |
| XLogP | 4.74 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|