C31H37N3O9 — CID 70954401
methyl 5-[8-[[bis(2-methoxy-2-oxoethyl)amino]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl]pentanoate (PubChem CID 70954401) has the molecular formula C31H37N3O9 and a molecular weight of 595.65 g/mol. Its IUPAC name is methyl 5-[8-[[bis(2-methoxy-2-oxoethyl)amino]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl]pentanoate.
| Compound Name | methyl 5-[8-[[bis(2-methoxy-2-oxoethyl)amino]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl]pentanoate |
|---|---|
| PubChem CID | 70954401 |
| Molecular Formula | C31H37N3O9 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | methyl 5-[8-[[bis(2-methoxy-2-oxoethyl)amino]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl]pentanoate |
| SMILES | COC(=O)CCCCN1c2ccccc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])cc(CN(CC(=O)OC)CC(=O)OC)c1O2 |
| InChI | InChI=1S/C31H37N3O9/c1-30(2)24-10-6-7-11-25(24)33(15-9-8-12-26(35)40-3)31(30)14-13-21-16-23(34(38)39)17-22(29(21)43-31)18-32(19-27(36)41-4)20-28(37)42-5/h6-7,10-11,13-14,16-17H,8-9,12,15,18-20H2,1-5H3 |
| InChIKey | IYGUCILOGQNLRY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 137.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|