C28H26N2O6 — CID 59184974
methyl 4-[(8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]benzoate (PubChem CID 59184974) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is methyl 4-[(8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]benzoate.
| Compound Name | methyl 4-[(8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]benzoate |
|---|---|
| PubChem CID | 59184974 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | methyl 4-[(8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2c3ccccc3C(C)(C)C23C=Cc2cc([N+](=O)[O-])cc(OC)c2O3)cc1 |
| InChI | InChI=1S/C28H26N2O6/c1-27(2)22-7-5-6-8-23(22)29(17-18-9-11-19(12-10-18)26(31)35-4)28(27)14-13-20-15-21(30(32)33)16-24(34-3)25(20)36-28/h5-16H,17H2,1-4H3 |
| InChIKey | HTCCAOCTUALSLG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|