C22H24N2O4 — CID 14694039
8-methoxy-3',3'-dimethyl-6-nitro-1'-propan-2-ylspiro[chromene-2,2'-indole] (PubChem CID 14694039) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 8-methoxy-3',3'-dimethyl-6-nitro-1'-propan-2-ylspiro[chromene-2,2'-indole].
| Compound Name | 8-methoxy-3',3'-dimethyl-6-nitro-1'-propan-2-ylspiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 14694039 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 8-methoxy-3',3'-dimethyl-6-nitro-1'-propan-2-ylspiro[chromene-2,2'-indole] |
| SMILES | COc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(C(C)C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C22H24N2O4/c1-14(2)23-18-9-7-6-8-17(18)21(3,4)22(23)11-10-15-12-16(24(25)26)13-19(27-5)20(15)28-22/h6-14H,1-5H3 |
| InChIKey | BWFPHWHEUKNIIW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|