C20H20N2O4 — CID 1100892
(2R)-6-methoxy-1',3',3'-trimethyl-8-nitrospiro[chromene-2,2'-indole] (PubChem CID 1100892) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (2R)-6-methoxy-1',3',3'-trimethyl-8-nitrospiro[chromene-2,2'-indole].
| Compound Name | (2R)-6-methoxy-1',3',3'-trimethyl-8-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 1100892 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (2R)-6-methoxy-1',3',3'-trimethyl-8-nitrospiro[chromene-2,2'-indole] |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1)O[C@@]1(C=C2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C20H20N2O4/c1-19(2)15-7-5-6-8-16(15)21(3)20(19)10-9-13-11-14(25-4)12-17(22(23)24)18(13)26-20/h5-12H,1-4H3/t20-/m1/s1 |
| InChIKey | XNKRDFHPVAZCQX-HXUWFJFHSA-N |
| XLogP | 4.13 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|