C21H22N2O4 — CID 19083794
6-methoxy-1',3',3',6'-tetramethyl-8-nitrospiro[chromene-2,2'-indole] (PubChem CID 19083794) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 6-methoxy-1',3',3',6'-tetramethyl-8-nitrospiro[chromene-2,2'-indole].
| Compound Name | 6-methoxy-1',3',3',6'-tetramethyl-8-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 19083794 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 6-methoxy-1',3',3',6'-tetramethyl-8-nitrospiro[chromene-2,2'-indole] |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1)OC1(C=C2)N(C)c2cc(C)ccc2C1(C)C |
| InChI | InChI=1S/C21H22N2O4/c1-13-6-7-16-17(10-13)22(4)21(20(16,2)3)9-8-14-11-15(26-5)12-18(23(24)25)19(14)27-21/h6-12H,1-5H3 |
| InChIKey | BBPUXNUCHIVJKZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|