C26H24N2O4 — CID 19083949
8-methoxy-1',3',3'-trimethyl-5-nitro-5'-phenylspiro[chromene-2,2'-indole] (PubChem CID 19083949) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 8-methoxy-1',3',3'-trimethyl-5-nitro-5'-phenylspiro[chromene-2,2'-indole].
| Compound Name | 8-methoxy-1',3',3'-trimethyl-5-nitro-5'-phenylspiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 19083949 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 8-methoxy-1',3',3'-trimethyl-5-nitro-5'-phenylspiro[chromene-2,2'-indole] |
| SMILES | COc1ccc([N+](=O)[O-])c2c1OC1(C=C2)N(C)c2ccc(-c3ccccc3)cc2C1(C)C |
| InChI | InChI=1S/C26H24N2O4/c1-25(2)20-16-18(17-8-6-5-7-9-17)10-11-22(20)27(3)26(25)15-14-19-21(28(29)30)12-13-23(31-4)24(19)32-26/h5-16H,1-4H3 |
| InChIKey | UPQDNUBKJGSXJS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|