C22H23IN2O4 — CID 46209963
1'-(3-iodopropyl)-8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 46209963) has the molecular formula C22H23IN2O4 and a molecular weight of 506.34 g/mol. Its IUPAC name is 1'-(3-iodopropyl)-8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 1'-(3-iodopropyl)-8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 46209963 |
| Molecular Formula | C22H23IN2O4 |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 1'-(3-iodopropyl)-8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | COc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(CCCI)c2ccccc2C1(C)C |
| InChI | InChI=1S/C22H23IN2O4/c1-21(2)17-7-4-5-8-18(17)24(12-6-11-23)22(21)10-9-15-13-16(25(26)27)14-19(28-3)20(15)29-22/h4-5,7-10,13-14H,6,11-12H2,1-3H3 |
| InChIKey | VIWJHUMPQGNMGL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|