C30H34N3O3+ — CID 177468773
(2S)-1'-hexyl-3',3'-dimethyl-6-nitro-8-(pyridin-1-ium-1-ylmethyl)spiro[chromene-2,2'-indole] (PubChem CID 177468773) has the molecular formula C30H34N3O3+ and a molecular weight of 484.62 g/mol. Its IUPAC name is (2S)-1'-hexyl-3',3'-dimethyl-6-nitro-8-(pyridin-1-ium-1-ylmethyl)spiro[chromene-2,2'-indole].
| Compound Name | (2S)-1'-hexyl-3',3'-dimethyl-6-nitro-8-(pyridin-1-ium-1-ylmethyl)spiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 177468773 |
| Molecular Formula | C30H34N3O3+ |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (2S)-1'-hexyl-3',3'-dimethyl-6-nitro-8-(pyridin-1-ium-1-ylmethyl)spiro[chromene-2,2'-indole] |
| SMILES | CCCCCCN1c2ccccc2C(C)(C)[C@@]12C=Cc1cc([N+](=O)[O-])cc(C[n+]3ccccc3)c1O2 |
| InChI | InChI=1S/C30H34N3O3/c1-4-5-6-12-19-32-27-14-9-8-13-26(27)29(2,3)30(32)16-15-23-20-25(33(34)35)21-24(28(23)36-30)22-31-17-10-7-11-18-31/h7-11,13-18,20-21H,4-6,12,19,22H2,1-3H3/q+1/t30-/m0/s1 |
| InChIKey | CINZIZOMXRKJBG-PMERELPUSA-N |
| XLogP | 6.41 |
| TPSA | 59.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|