C28H26N2O4 — CID 72537120
8-methoxy-3',3'-dimethyl-6-nitro-1'-(3-phenylprop-2-enyl)spiro[chromene-2,2'-indole] (PubChem CID 72537120) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 8-methoxy-3',3'-dimethyl-6-nitro-1'-(3-phenylprop-2-enyl)spiro[chromene-2,2'-indole].
| Compound Name | 8-methoxy-3',3'-dimethyl-6-nitro-1'-(3-phenylprop-2-enyl)spiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 72537120 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 8-methoxy-3',3'-dimethyl-6-nitro-1'-(3-phenylprop-2-enyl)spiro[chromene-2,2'-indole] |
| SMILES | COc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(CC=Cc2ccccc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C28H26N2O4/c1-27(2)23-13-7-8-14-24(23)29(17-9-12-20-10-5-4-6-11-20)28(27)16-15-21-18-22(30(31)32)19-25(33-3)26(21)34-28/h4-16,18-19H,17H2,1-3H3 |
| InChIKey | NGQGQVRVODWUKG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|