C27H26N2O6 — CID 58298835
ethyl 2-(8'-methoxy-3,3-dimethyl-6'-nitrospiro[benzo[g]indole-2,2'-chromene]-1-yl)acetate (PubChem CID 58298835) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is ethyl 2-(8'-methoxy-3,3-dimethyl-6'-nitrospiro[benzo[g]indole-2,2'-chromene]-1-yl)acetate.
| Compound Name | ethyl 2-(8'-methoxy-3,3-dimethyl-6'-nitrospiro[benzo[g]indole-2,2'-chromene]-1-yl)acetate |
|---|---|
| PubChem CID | 58298835 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | ethyl 2-(8'-methoxy-3,3-dimethyl-6'-nitrospiro[benzo[g]indole-2,2'-chromene]-1-yl)acetate |
| SMILES | CCOC(=O)CN1c2c(ccc3ccccc23)C(C)(C)C12C=Cc1cc([N+](=O)[O-])cc(OC)c1O2 |
| InChI | InChI=1S/C27H26N2O6/c1-5-34-23(30)16-28-24-20-9-7-6-8-17(20)10-11-21(24)26(2,3)27(28)13-12-18-14-19(29(31)32)15-22(33-4)25(18)35-27/h6-15H,5,16H2,1-4H3 |
| InChIKey | YYIWIZHCLYUHMU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|