C47H44N4O7 — CID 59476923
[1'-[[4-[(8-ethyl-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl]methanol (PubChem CID 59476923) has the molecular formula C47H44N4O7 and a molecular weight of 776.89 g/mol. Its IUPAC name is [1'-[[4-[(8-ethyl-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl]methanol.
| Compound Name | [1'-[[4-[(8-ethyl-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl]methanol |
|---|---|
| PubChem CID | 59476923 |
| Molecular Formula | C47H44N4O7 |
| Molecular Weight | 776.89 g/mol |
| Exact Mass | 776.32 |
| IUPAC Name | [1'-[[4-[(8-ethyl-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl]methanol |
| SMILES | CCc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(Cc2ccc(CN3c4ccccc4C(C)(C)C34C=Cc3cc([N+](=O)[O-])cc(CO)c3O4)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C47H44N4O7/c1-6-32-23-36(50(53)54)24-33-19-21-46(57-42(32)33)44(2,3)38-11-7-9-13-40(38)48(46)27-30-15-17-31(18-16-30)28-49-41-14-10-8-12-39(41)45(4,5)47(49)22-20-34-25-37(51(55)56)26-35(29-52)43(34)58-47/h7-26,52H,6,27-29H2,1-5H3 |
| InChIKey | PBPDIKPFOHQIBI-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.89 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|