C25H26IN3O7 — CID 44539982
2-[carboxymethyl-[2-[8-(iodomethyl)-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl]ethyl]amino]acetic acid (PubChem CID 44539982) has the molecular formula C25H26IN3O7 and a molecular weight of 607.40 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[8-(iodomethyl)-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl]ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-[8-(iodomethyl)-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 44539982 |
| Molecular Formula | C25H26IN3O7 |
| Molecular Weight | 607.40 g/mol |
| Exact Mass | 607.08 |
| IUPAC Name | 2-[carboxymethyl-[2-[8-(iodomethyl)-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl]ethyl]amino]acetic acid |
| SMILES | CC1(C)c2ccccc2N(CCN(CC(=O)O)CC(=O)O)C12C=Cc1cc([N+](=O)[O-])cc(CI)c1O2 |
| InChI | InChI=1S/C25H26IN3O7/c1-24(2)19-5-3-4-6-20(19)28(10-9-27(14-21(30)31)15-22(32)33)25(24)8-7-16-11-18(29(34)35)12-17(13-26)23(16)36-25/h3-8,11-12H,9-10,13-15H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | HUJJCBLXEBZXGX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|