C26H22F2N2O4 — CID 59184961
1'-[(2,4-difluorophenyl)methyl]-8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 59184961) has the molecular formula C26H22F2N2O4 and a molecular weight of 464.47 g/mol. Its IUPAC name is 1'-[(2,4-difluorophenyl)methyl]-8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 1'-[(2,4-difluorophenyl)methyl]-8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 59184961 |
| Molecular Formula | C26H22F2N2O4 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 1'-[(2,4-difluorophenyl)methyl]-8-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | COc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(Cc2ccc(F)cc2F)c2ccccc2C1(C)C |
| InChI | InChI=1S/C26H22F2N2O4/c1-25(2)20-6-4-5-7-22(20)29(15-17-8-9-18(27)13-21(17)28)26(25)11-10-16-12-19(30(31)32)14-23(33-3)24(16)34-26/h4-14H,15H2,1-3H3 |
| InChIKey | JCKRSZQLTKQRRG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|