C26H25FN2O2 — CID 143659969
1'-[(4-fluorophenyl)methyl]-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-amine (PubChem CID 143659969) has the molecular formula C26H25FN2O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is 1'-[(4-fluorophenyl)methyl]-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-amine.
| Compound Name | 1'-[(4-fluorophenyl)methyl]-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-amine |
|---|---|
| PubChem CID | 143659969 |
| Molecular Formula | C26H25FN2O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1'-[(4-fluorophenyl)methyl]-8-methoxy-3',3'-dimethylspiro[chromene-2,2'-indole]-6-amine |
| SMILES | COc1cc(N)cc2c1OC1(C=C2)N(Cc2ccc(F)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C26H25FN2O2/c1-25(2)21-6-4-5-7-22(21)29(16-17-8-10-19(27)11-9-17)26(25)13-12-18-14-20(28)15-23(30-3)24(18)31-26/h4-15H,16,28H2,1-3H3 |
| InChIKey | BTUMITVIVLFSFT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|