C19H18N2O3 — CID 40636806
(2S)-1',3',3'-trimethyl-7-nitrospiro[chromene-2,2'-indole] (PubChem CID 40636806) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2S)-1',3',3'-trimethyl-7-nitrospiro[chromene-2,2'-indole].
| Compound Name | (2S)-1',3',3'-trimethyl-7-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 40636806 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (2S)-1',3',3'-trimethyl-7-nitrospiro[chromene-2,2'-indole] |
| SMILES | CN1c2ccccc2C(C)(C)[C@@]12C=Cc1ccc([N+](=O)[O-])cc1O2 |
| InChI | InChI=1S/C19H18N2O3/c1-18(2)15-6-4-5-7-16(15)20(3)19(18)11-10-13-8-9-14(21(22)23)12-17(13)24-19/h4-12H,1-3H3/t19-/m0/s1 |
| InChIKey | AEUPYUQQBBOQTL-IBGZPJMESA-N |
| XLogP | 4.12 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|