C19H18N2O4 — CID 14766372
1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-5'-ol (PubChem CID 14766372) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-5'-ol.
| Compound Name | 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-5'-ol |
|---|---|
| PubChem CID | 14766372 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-5'-ol |
| SMILES | CN1c2ccc(O)cc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C19H18N2O4/c1-18(2)15-11-14(22)5-6-16(15)20(3)19(18)9-8-12-10-13(21(23)24)4-7-17(12)25-19/h4-11,22H,1-3H3 |
| InChIKey | KSTQEFGTQMDXGC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|