C23H23ClN2O6 — CID 101435752
2-(5'-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl 2-chloroacetate (PubChem CID 101435752) has the molecular formula C23H23ClN2O6 and a molecular weight of 458.90 g/mol. Its IUPAC name is 2-(5'-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl 2-chloroacetate.
| Compound Name | 2-(5'-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl 2-chloroacetate |
|---|---|
| PubChem CID | 101435752 |
| Molecular Formula | C23H23ClN2O6 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-(5'-methoxy-3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl 2-chloroacetate |
| SMILES | COc1ccc2c(c1)C(C)(C)C1(C=Cc3cc([N+](=O)[O-])ccc3O1)N2CCOC(=O)CCl |
| InChI | InChI=1S/C23H23ClN2O6/c1-22(2)18-13-17(30-3)5-6-19(18)25(10-11-31-21(27)14-24)23(22)9-8-15-12-16(26(28)29)4-7-20(15)32-23/h4-9,12-13H,10-11,14H2,1-3H3 |
| InChIKey | UCPMLQQMTLGBSE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|