C32H37BrN2O9 — CID 143870733
2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl 2-(2-bromopropanoyloxymethyl)-3-butanoyloxy-2-methylpropanoate (PubChem CID 143870733) has the molecular formula C32H37BrN2O9 and a molecular weight of 673.56 g/mol. Its IUPAC name is 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl 2-(2-bromopropanoyloxymethyl)-3-butanoyloxy-2-methylpropanoate.
| Compound Name | 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl 2-(2-bromopropanoyloxymethyl)-3-butanoyloxy-2-methylpropanoate |
|---|---|
| PubChem CID | 143870733 |
| Molecular Formula | C32H37BrN2O9 |
| Molecular Weight | 673.56 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl 2-(2-bromopropanoyloxymethyl)-3-butanoyloxy-2-methylpropanoate |
| SMILES | CCCC(=O)OCC(C)(COC(=O)C(C)Br)C(=O)OCCN1c2ccccc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C32H37BrN2O9/c1-6-9-27(36)42-19-31(5,20-43-28(37)21(2)33)29(38)41-17-16-34-25-11-8-7-10-24(25)30(3,4)32(34)15-14-22-18-23(35(39)40)12-13-26(22)44-32/h7-8,10-15,18,21H,6,9,16-17,19-20H2,1-5H3 |
| InChIKey | DYPZHJXJEGNLKD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|