C26H23N3O5 — CID 177481033
2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl pyridine-4-carboxylate (PubChem CID 177481033) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl pyridine-4-carboxylate.
| Compound Name | 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl pyridine-4-carboxylate |
|---|---|
| PubChem CID | 177481033 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)ethyl pyridine-4-carboxylate |
| SMILES | CC1(C)c2ccccc2N(CCOC(=O)c2ccncc2)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C26H23N3O5/c1-25(2)21-5-3-4-6-22(21)28(15-16-33-24(30)18-10-13-27-14-11-18)26(25)12-9-19-17-20(29(31)32)7-8-23(19)34-26/h3-14,17H,15-16H2,1-2H3 |
| InChIKey | ULVYUYRMRKIJFS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|