About 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol
2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol (PubChem CID 54462986) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol |
| PubChem CID | 54462986 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol |
| SMILES | CC1(C)c2ccc([N+](=O)[O-])cc2N(CCO)C12C=Cc1ccccc1O2 |
| InChI | InChI=1S/C20H20N2O4/c1-19(2)16-8-7-15(22(24)25)13-17(16)21(11-12-23)20(19)10-9-14-5-3-4-6-18(14)26-20/h3-10,13,23H,11-12H2,1-2H3 |
| InChIKey | XCXFGLFSNGDZJT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol?
The IUPAC name of 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol (CID 54462986) is 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol.
What is the SMILES notation for 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol?
The canonical SMILES for 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol is CC1(C)c2ccc([N+](=O)[O-])cc2N(CCO)C12C=Cc1ccccc1O2.
What is the InChIKey of 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol?
The InChIKey is XCXFGLFSNGDZJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4/c1-19(2)16-8-7-15(22(24)25)13-17(16)21(11-12-23)20(19)10-9-14-5-3-4-6-18(14)26-20/h3-10,13,23H,11-12H2,1-2H3.
What are the key properties of 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol?
2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol has a molecular weight of 352.39 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3',3'-dimethyl-6'-nitrospiro[chromene-2,2'-indole]-1'-yl)ethanol is sourced from PubChem (CID 54462986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).