C21H23NO2 — CID 167694327
2-[(2R)-3',3',5'-trimethylspiro[chromene-2,2'-indole]-1'-yl]ethanol (PubChem CID 167694327) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[(2R)-3',3',5'-trimethylspiro[chromene-2,2'-indole]-1'-yl]ethanol.
| Compound Name | 2-[(2R)-3',3',5'-trimethylspiro[chromene-2,2'-indole]-1'-yl]ethanol |
|---|---|
| PubChem CID | 167694327 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[(2R)-3',3',5'-trimethylspiro[chromene-2,2'-indole]-1'-yl]ethanol |
| SMILES | Cc1ccc2c(c1)C(C)(C)[C@]1(C=Cc3ccccc3O1)N2CCO |
| InChI | InChI=1S/C21H23NO2/c1-15-8-9-18-17(14-15)20(2,3)21(22(18)12-13-23)11-10-16-6-4-5-7-19(16)24-21/h4-11,14,23H,12-13H2,1-3H3/t21-/m1/s1 |
| InChIKey | MEXOXXNCKUYQAQ-OAQYLSRUSA-N |
| XLogP | 3.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |