C33H30NO3P — CID 167651859
diphenylphosphoryl-(1',3',3',5'-tetramethylspiro[chromene-2,2'-indole]-6-yl)methanone (PubChem CID 167651859) has the molecular formula C33H30NO3P and a molecular weight of 519.58 g/mol. Its IUPAC name is diphenylphosphoryl-(1',3',3',5'-tetramethylspiro[chromene-2,2'-indole]-6-yl)methanone.
| Compound Name | diphenylphosphoryl-(1',3',3',5'-tetramethylspiro[chromene-2,2'-indole]-6-yl)methanone |
|---|---|
| PubChem CID | 167651859 |
| Molecular Formula | C33H30NO3P |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | diphenylphosphoryl-(1',3',3',5'-tetramethylspiro[chromene-2,2'-indole]-6-yl)methanone |
| SMILES | Cc1ccc2c(c1)C(C)(C)C1(C=Cc3cc(C(=O)P(=O)(c4ccccc4)c4ccccc4)ccc3O1)N2C |
| InChI | InChI=1S/C33H30NO3P/c1-23-15-17-29-28(21-23)32(2,3)33(34(29)4)20-19-24-22-25(16-18-30(24)37-33)31(35)38(36,26-11-7-5-8-12-26)27-13-9-6-10-14-27/h5-22H,1-4H3 |
| InChIKey | QRPFVFMYGALHLV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|