C26H23FN2O4S — CID 165164659
6-(4-fluorobenzoyl)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-5'-sulfonamide (PubChem CID 165164659) has the molecular formula C26H23FN2O4S and a molecular weight of 478.55 g/mol. Its IUPAC name is 6-(4-fluorobenzoyl)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-5'-sulfonamide.
| Compound Name | 6-(4-fluorobenzoyl)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-5'-sulfonamide |
|---|---|
| PubChem CID | 165164659 |
| Molecular Formula | C26H23FN2O4S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 6-(4-fluorobenzoyl)-1',3',3'-trimethylspiro[chromene-2,2'-indole]-5'-sulfonamide |
| SMILES | CN1c2ccc(S(N)(=O)=O)cc2C(C)(C)C12C=Cc1cc(C(=O)c3ccc(F)cc3)ccc1O2 |
| InChI | InChI=1S/C26H23FN2O4S/c1-25(2)21-15-20(34(28,31)32)9-10-22(21)29(3)26(25)13-12-17-14-18(6-11-23(17)33-26)24(30)16-4-7-19(27)8-5-16/h4-15H,1-3H3,(H2,28,31,32) |
| InChIKey | CWODQZFMHVQUPD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |