C23H20Cl2F3NO2 — CID 170384952
2,2-dichloro-1-[1',3',3'-trimethyl-5'-(trifluoromethyl)spiro[chromene-2,2'-indole]-6-yl]propan-1-one (PubChem CID 170384952) has the molecular formula C23H20Cl2F3NO2 and a molecular weight of 470.32 g/mol. Its IUPAC name is 2,2-dichloro-1-[1',3',3'-trimethyl-5'-(trifluoromethyl)spiro[chromene-2,2'-indole]-6-yl]propan-1-one.
| Compound Name | 2,2-dichloro-1-[1',3',3'-trimethyl-5'-(trifluoromethyl)spiro[chromene-2,2'-indole]-6-yl]propan-1-one |
|---|---|
| PubChem CID | 170384952 |
| Molecular Formula | C23H20Cl2F3NO2 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 2,2-dichloro-1-[1',3',3'-trimethyl-5'-(trifluoromethyl)spiro[chromene-2,2'-indole]-6-yl]propan-1-one |
| SMILES | CN1c2ccc(C(F)(F)F)cc2C(C)(C)C12C=Cc1cc(C(=O)C(C)(Cl)Cl)ccc1O2 |
| InChI | InChI=1S/C23H20Cl2F3NO2/c1-20(2)16-12-15(23(26,27)28)6-7-17(16)29(4)22(20)10-9-13-11-14(5-8-18(13)31-22)19(30)21(3,24)25/h5-12H,1-4H3 |
| InChIKey | IBLDIAPJTPKAAZ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|