C19H17BrN2O3 — CID 7360783
(2R)-6-bromo-1',3',3'-trimethyl-5'-nitrospiro[chromene-2,2'-indole] (PubChem CID 7360783) has the molecular formula C19H17BrN2O3 and a molecular weight of 401.26 g/mol. Its IUPAC name is (2R)-6-bromo-1',3',3'-trimethyl-5'-nitrospiro[chromene-2,2'-indole].
| Compound Name | (2R)-6-bromo-1',3',3'-trimethyl-5'-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 7360783 |
| Molecular Formula | C19H17BrN2O3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (2R)-6-bromo-1',3',3'-trimethyl-5'-nitrospiro[chromene-2,2'-indole] |
| SMILES | CN1c2ccc([N+](=O)[O-])cc2C(C)(C)[C@]12C=Cc1cc(Br)ccc1O2 |
| InChI | InChI=1S/C19H17BrN2O3/c1-18(2)15-11-14(22(23)24)5-6-16(15)21(3)19(18)9-8-12-10-13(20)4-7-17(12)25-19/h4-11H,1-3H3/t19-/m1/s1 |
| InChIKey | OMOQPYVLAIHVOU-LJQANCHMSA-N |
| XLogP | 4.89 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|