C23H30N2O3 — CID 157271788
ethane;1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 157271788) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is ethane;1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | ethane;1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 157271788 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | ethane;1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CC.CC.CN1c2ccccc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C19H18N2O3.2C2H6/c1-18(2)15-6-4-5-7-16(15)20(3)19(18)11-10-13-12-14(21(22)23)8-9-17(13)24-19;2*1-2/h4-12H,1-3H3;2*1-2H3 |
| InChIKey | AYPWPHLDFLTERG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|