C31H30Br2N4O3 — CID 139095259
(2S)-3',3'-dimethyl-1'-[2-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]ethyl]-6-nitrospiro[chromene-2,2'-indole] dibromide (PubChem CID 139095259) has the molecular formula C31H30Br2N4O3 and a molecular weight of 666.41 g/mol. Its IUPAC name is (2S)-3',3'-dimethyl-1'-[2-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]ethyl]-6-nitrospiro[chromene-2,2'-indole] dibromide.
| Compound Name | (2S)-3',3'-dimethyl-1'-[2-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]ethyl]-6-nitrospiro[chromene-2,2'-indole] dibromide |
|---|---|
| PubChem CID | 139095259 |
| Molecular Formula | C31H30Br2N4O3 |
| Molecular Weight | 666.41 g/mol |
| Exact Mass | 664.07 |
| IUPAC Name | (2S)-3',3'-dimethyl-1'-[2-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]ethyl]-6-nitrospiro[chromene-2,2'-indole] dibromide |
| SMILES | C[n+]1ccc(-c2cc[n+](CCN3c4ccccc4C(C)(C)[C@@]34C=Cc3cc([N+](=O)[O-])ccc3O4)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C31H30N4O3.2BrH/c1-30(2)27-6-4-5-7-28(27)34(31(30)15-10-25-22-26(35(36)37)8-9-29(25)38-31)21-20-33-18-13-24(14-19-33)23-11-16-32(3)17-12-23;;/h4-19,22H,20-21H2,1-3H3;2*1H/q+2;;/p-2/t31-;;/m0../s1 |
| InChIKey | BMJWWVLGWSXEHO-ATQCJDTDSA-L |
| XLogP | -1.02 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.41 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|